2-bromo-N-(2-{2-[(2-iodophenyl)methylidene]hydrazinecarbonyl}phenyl)benzamide
Chemical Structure Depiction of
2-bromo-N-(2-{2-[(2-iodophenyl)methylidene]hydrazinecarbonyl}phenyl)benzamide
2-bromo-N-(2-{2-[(2-iodophenyl)methylidene]hydrazinecarbonyl}phenyl)benzamide
Compound characteristics
| Compound ID: | 8004-0172 |
| Compound Name: | 2-bromo-N-(2-{2-[(2-iodophenyl)methylidene]hydrazinecarbonyl}phenyl)benzamide |
| Molecular Weight: | 548.18 |
| Molecular Formula: | C21 H15 Br I N3 O2 |
| Smiles: | C(\c1ccccc1I)=N/NC(c1ccccc1NC(c1ccccc1[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8314 |
| logD: | 4.7801 |
| logSw: | -4.7933 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.948 |
| InChI Key: | NYYSUQJELREKSW-UHFFFAOYSA-N |