4-[(2-{[(benzenesulfonyl)(3-methylphenyl)amino]acetyl}hydrazinylidene)methyl]phenyl benzoate
Chemical Structure Depiction of
4-[(2-{[(benzenesulfonyl)(3-methylphenyl)amino]acetyl}hydrazinylidene)methyl]phenyl benzoate
4-[(2-{[(benzenesulfonyl)(3-methylphenyl)amino]acetyl}hydrazinylidene)methyl]phenyl benzoate
Compound characteristics
| Compound ID: | 8004-0295 |
| Compound Name: | 4-[(2-{[(benzenesulfonyl)(3-methylphenyl)amino]acetyl}hydrazinylidene)methyl]phenyl benzoate |
| Molecular Weight: | 527.6 |
| Molecular Formula: | C29 H25 N3 O5 S |
| Smiles: | Cc1cccc(c1)N(CC(N/N=C/c1ccc(cc1)OC(c1ccccc1)=O)=O)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9221 |
| logD: | 4.9219 |
| logSw: | -4.7037 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.544 |
| InChI Key: | FNAVYRCFOUHQRT-UHFFFAOYSA-N |