N-(3,4-dichlorophenyl)-N-(2-{2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide
Chemical Structure Depiction of
N-(3,4-dichlorophenyl)-N-(2-{2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide
N-(3,4-dichlorophenyl)-N-(2-{2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide
Compound characteristics
| Compound ID: | 8004-0314 |
| Compound Name: | N-(3,4-dichlorophenyl)-N-(2-{2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide |
| Molecular Weight: | 564.49 |
| Molecular Formula: | C26 H27 Cl2 N3 O5 S |
| Smiles: | CCCOc1ccc(/C=N/NC(CN(c2ccc(c(c2)[Cl])[Cl])S(c2ccccc2)(=O)=O)=O)cc1OCC |
| Stereo: | ACHIRAL |
| logP: | 5.7016 |
| logD: | 5.7014 |
| logSw: | -6.0502 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.881 |
| InChI Key: | CVAHFTBKFQXZEA-UHFFFAOYSA-N |