1,1',1''-(1,3,5-triazinane-1,3,5-triyl)tri(ethan-1-one)
Chemical Structure Depiction of
1,1',1''-(1,3,5-triazinane-1,3,5-triyl)tri(ethan-1-one)
1,1',1''-(1,3,5-triazinane-1,3,5-triyl)tri(ethan-1-one)
Compound characteristics
| Compound ID: | 8004-0660 |
| Compound Name: | 1,1',1''-(1,3,5-triazinane-1,3,5-triyl)tri(ethan-1-one) |
| Molecular Weight: | 213.23 |
| Molecular Formula: | C9 H15 N3 O3 |
| Smiles: | CC(N1CN(CN(C1)C(C)=O)C(C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.5378 |
| logD: | -0.5378 |
| logSw: | 0.3634 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.237 |
| InChI Key: | OAQRIDXOGCNRLX-UHFFFAOYSA-N |