N'-{1-[4-(propan-2-yl)phenyl]ethylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide
Chemical Structure Depiction of
N'-{1-[4-(propan-2-yl)phenyl]ethylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide
N'-{1-[4-(propan-2-yl)phenyl]ethylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide
Compound characteristics
| Compound ID: | 8004-0703 |
| Compound Name: | N'-{1-[4-(propan-2-yl)phenyl]ethylidene}-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetohydrazide |
| Molecular Weight: | 422.61 |
| Molecular Formula: | C27 H38 N2 O2 |
| Smiles: | CC(C)c1ccc(cc1)C(/C)=N/NC(COc1ccc(cc1)C(C)(C)CC(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 7.6261 |
| logD: | 7.6255 |
| logSw: | -5.7448 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.128 |
| InChI Key: | SEIGNEVDAVFCRY-UHFFFAOYSA-N |