N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)-2,2-diphenylacetamide
Chemical Structure Depiction of
N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)-2,2-diphenylacetamide
N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)-2,2-diphenylacetamide
Compound characteristics
| Compound ID: | 8004-1063 |
| Compound Name: | N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)-2,2-diphenylacetamide |
| Molecular Weight: | 416.44 |
| Molecular Formula: | C23 H20 N4 O4 |
| Smiles: | C(C(N/N=C/c1ccc(cc1)[N+]([O-])=O)=O)NC(C(c1ccccc1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7655 |
| logD: | 3.7652 |
| logSw: | -4.1325 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.136 |
| InChI Key: | HZELBIARXPUIAB-UHFFFAOYSA-N |