N'-({2-[cyclohexyl(methyl)amino]-5-nitrophenyl}methylidene)-2-(2-methylphenoxy)acetohydrazide
Chemical Structure Depiction of
N'-({2-[cyclohexyl(methyl)amino]-5-nitrophenyl}methylidene)-2-(2-methylphenoxy)acetohydrazide
N'-({2-[cyclohexyl(methyl)amino]-5-nitrophenyl}methylidene)-2-(2-methylphenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8004-1203 |
| Compound Name: | N'-({2-[cyclohexyl(methyl)amino]-5-nitrophenyl}methylidene)-2-(2-methylphenoxy)acetohydrazide |
| Molecular Weight: | 424.5 |
| Molecular Formula: | C23 H28 N4 O4 |
| Smiles: | Cc1ccccc1OCC(N/N=C/c1cc(ccc1N(C)C1CCCCC1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1327 |
| logD: | 5.1327 |
| logSw: | -4.9406 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.013 |
| InChI Key: | MPVVNQZQYRWZOB-UHFFFAOYSA-N |