N'-{[5-(4-chlorophenyl)furan-2-yl]methylidene}-2-(2-methylanilino)acetohydrazide
Chemical Structure Depiction of
N'-{[5-(4-chlorophenyl)furan-2-yl]methylidene}-2-(2-methylanilino)acetohydrazide
N'-{[5-(4-chlorophenyl)furan-2-yl]methylidene}-2-(2-methylanilino)acetohydrazide
Compound characteristics
| Compound ID: | 8004-1269 |
| Compound Name: | N'-{[5-(4-chlorophenyl)furan-2-yl]methylidene}-2-(2-methylanilino)acetohydrazide |
| Molecular Weight: | 367.83 |
| Molecular Formula: | C20 H18 Cl N3 O2 |
| Smiles: | Cc1ccccc1NCC(N/N=C/c1ccc(c2ccc(cc2)[Cl])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2609 |
| logD: | 5.2609 |
| logSw: | -5.8584 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.719 |
| InChI Key: | LAFOKRRBALJAPC-UHFFFAOYSA-N |