N~4~-(3-chloro-4-methylphenyl)-6-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-N~2~,N~2~-diethyl-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
N~4~-(3-chloro-4-methylphenyl)-6-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-N~2~,N~2~-diethyl-1,3,5-triazine-2,4-diamine
N~4~-(3-chloro-4-methylphenyl)-6-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-N~2~,N~2~-diethyl-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | 8004-2337 |
| Compound Name: | N~4~-(3-chloro-4-methylphenyl)-6-(2-{[4-(dimethylamino)phenyl]methylidene}hydrazinyl)-N~2~,N~2~-diethyl-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 452.99 |
| Molecular Formula: | C23 H29 Cl N8 |
| Smiles: | CCN(CC)c1nc(Nc2ccc(C)c(c2)[Cl])nc(N/N=C/c2ccc(cc2)N(C)C)n1 |
| Stereo: | ACHIRAL |
| logP: | 7.4805 |
| logD: | 7.4794 |
| logSw: | -6.7903 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.891 |
| InChI Key: | UUWAXONBIVRGCO-UHFFFAOYSA-N |