N'-(2-methyl-1-phenylpropylidene)-2-nitrobenzohydrazide
Chemical Structure Depiction of
N'-(2-methyl-1-phenylpropylidene)-2-nitrobenzohydrazide
N'-(2-methyl-1-phenylpropylidene)-2-nitrobenzohydrazide
Compound characteristics
| Compound ID: | 8004-3118 |
| Compound Name: | N'-(2-methyl-1-phenylpropylidene)-2-nitrobenzohydrazide |
| Molecular Weight: | 311.34 |
| Molecular Formula: | C17 H17 N3 O3 |
| Smiles: | CC(C)\C(c1ccccc1)=N/NC(c1ccccc1[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8309 |
| logD: | 3.4848 |
| logSw: | -4.1467 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.153 |
| InChI Key: | VONCCNUHAJDZNK-UHFFFAOYSA-N |