N'-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide
Chemical Structure Depiction of
N'-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide
N'-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide
Compound characteristics
| Compound ID: | 8004-4301 |
| Compound Name: | N'-[(5-chloro-2-hydroxyphenyl)methylidene]-2-[(naphthalen-2-yl)amino]acetohydrazide |
| Molecular Weight: | 353.81 |
| Molecular Formula: | C19 H16 Cl N3 O2 |
| Smiles: | C(C(N/N=C/c1cc(ccc1O)[Cl])=O)Nc1ccc2ccccc2c1 |
| Stereo: | ACHIRAL |
| logP: | 4.8148 |
| logD: | 4.8118 |
| logSw: | -4.8037 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 62.124 |
| InChI Key: | SXLWZYHINUOQNC-UHFFFAOYSA-N |