2-bromo-N-(2-{2-[1-(2,4-dimethylphenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide
Chemical Structure Depiction of
2-bromo-N-(2-{2-[1-(2,4-dimethylphenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide
2-bromo-N-(2-{2-[1-(2,4-dimethylphenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | 8004-4346 |
| Compound Name: | 2-bromo-N-(2-{2-[1-(2,4-dimethylphenyl)ethylidene]hydrazinyl}-2-oxoethyl)benzamide |
| Molecular Weight: | 402.29 |
| Molecular Formula: | C19 H20 Br N3 O2 |
| Smiles: | C\C(c1ccc(C)cc1C)=N/NC(CNC(c1ccccc1[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2567 |
| logD: | 4.2559 |
| logSw: | -4.2812 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.313 |
| InChI Key: | XUOJUGXLMKHZGR-HYARGMPZSA-N |