2-({[4-(1,3-benzoxazol-2-yl)phenyl]imino}methyl)-4,6-dichlorophenol
Chemical Structure Depiction of
2-({[4-(1,3-benzoxazol-2-yl)phenyl]imino}methyl)-4,6-dichlorophenol
2-({[4-(1,3-benzoxazol-2-yl)phenyl]imino}methyl)-4,6-dichlorophenol
Compound characteristics
| Compound ID: | 8004-4367 |
| Compound Name: | 2-({[4-(1,3-benzoxazol-2-yl)phenyl]imino}methyl)-4,6-dichlorophenol |
| Molecular Weight: | 383.23 |
| Molecular Formula: | C20 H12 Cl2 N2 O2 |
| Smiles: | C(\c1cc(cc(c1O)[Cl])[Cl])=N/c1ccc(cc1)c1nc2ccccc2o1 |
| Stereo: | ACHIRAL |
| logP: | 6.0887 |
| logD: | 5.5089 |
| logSw: | -5.9079 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.655 |
| InChI Key: | HGVZNJMURKJSNJ-UHFFFAOYSA-N |