2,4-dichloro-6-{[(3-hydroxyphenyl)imino]methyl}phenol
Chemical Structure Depiction of
2,4-dichloro-6-{[(3-hydroxyphenyl)imino]methyl}phenol
2,4-dichloro-6-{[(3-hydroxyphenyl)imino]methyl}phenol
Compound characteristics
| Compound ID: | 8004-4402 |
| Compound Name: | 2,4-dichloro-6-{[(3-hydroxyphenyl)imino]methyl}phenol |
| Molecular Weight: | 282.12 |
| Molecular Formula: | C13 H9 Cl2 N O2 |
| Smiles: | C(\c1cc(cc(c1O)[Cl])[Cl])=N/c1cccc(c1)O |
| Stereo: | ACHIRAL |
| logP: | 4.2546 |
| logD: | 3.6748 |
| logSw: | -3.8002 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.462 |
| InChI Key: | PQSMXZWBTGBSCT-UHFFFAOYSA-N |