2-iodo-6-({[2-(3-iodophenyl)-1,3-benzoxazol-6-yl]imino}methyl)phenol
Chemical Structure Depiction of
2-iodo-6-({[2-(3-iodophenyl)-1,3-benzoxazol-6-yl]imino}methyl)phenol
2-iodo-6-({[2-(3-iodophenyl)-1,3-benzoxazol-6-yl]imino}methyl)phenol
Compound characteristics
| Compound ID: | 8004-4646 |
| Compound Name: | 2-iodo-6-({[2-(3-iodophenyl)-1,3-benzoxazol-6-yl]imino}methyl)phenol |
| Molecular Weight: | 566.13 |
| Molecular Formula: | C20 H12 I2 N2 O2 |
| Smiles: | C(\c1cccc(c1O)I)=N/c1ccc2c(c1)oc(c1cccc(c1)I)n2 |
| Stereo: | ACHIRAL |
| logP: | 6.527 |
| logD: | 6.1474 |
| logSw: | -6.0894 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.655 |
| InChI Key: | QJIDEGKEPWMNCY-UHFFFAOYSA-N |