2-{2-[(3-bromophenyl)methylidene]hydrazinyl}-N-(2-fluorophenyl)-2-oxoacetamide
Chemical Structure Depiction of
2-{2-[(3-bromophenyl)methylidene]hydrazinyl}-N-(2-fluorophenyl)-2-oxoacetamide
2-{2-[(3-bromophenyl)methylidene]hydrazinyl}-N-(2-fluorophenyl)-2-oxoacetamide
Compound characteristics
| Compound ID: | 8004-5450 |
| Compound Name: | 2-{2-[(3-bromophenyl)methylidene]hydrazinyl}-N-(2-fluorophenyl)-2-oxoacetamide |
| Molecular Weight: | 364.17 |
| Molecular Formula: | C15 H11 Br F N3 O2 |
| Smiles: | C(\c1cccc(c1)[Br])=N/NC(C(Nc1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3617 |
| logD: | 1.2278 |
| logSw: | -3.6499 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.219 |
| InChI Key: | FRXFYOMKDKPLAW-UHFFFAOYSA-N |