3-({2-[(3,4-dimethylphenoxy)acetyl]hydrazinylidene}methyl)phenyl furan-2-carboxylate
Chemical Structure Depiction of
3-({2-[(3,4-dimethylphenoxy)acetyl]hydrazinylidene}methyl)phenyl furan-2-carboxylate
3-({2-[(3,4-dimethylphenoxy)acetyl]hydrazinylidene}methyl)phenyl furan-2-carboxylate
Compound characteristics
| Compound ID: | 8004-5855 |
| Compound Name: | 3-({2-[(3,4-dimethylphenoxy)acetyl]hydrazinylidene}methyl)phenyl furan-2-carboxylate |
| Molecular Weight: | 392.41 |
| Molecular Formula: | C22 H20 N2 O5 |
| Smiles: | Cc1ccc(cc1C)OCC(N/N=C/c1cccc(c1)OC(c1ccco1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.114 |
| logD: | 4.1139 |
| logSw: | -4.3001 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.796 |
| InChI Key: | BUJHHOYOPFQDIR-UHFFFAOYSA-N |