N'-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,6-dimethylphenoxy)acetohydrazide
Chemical Structure Depiction of
N'-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,6-dimethylphenoxy)acetohydrazide
N'-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,6-dimethylphenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 8004-5921 |
| Compound Name: | N'-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2-(2,6-dimethylphenoxy)acetohydrazide |
| Molecular Weight: | 376.84 |
| Molecular Formula: | C19 H21 Cl N2 O4 |
| Smiles: | CCOc1cc(/C=N/NC(COc2c(C)cccc2C)=O)cc(c1O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.9079 |
| logD: | 4.8833 |
| logSw: | -4.6453 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.703 |
| InChI Key: | FHNOTVRPCOTWTF-UHFFFAOYSA-N |