2-(2,4-dichlorophenoxy)-N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(2,4-dichlorophenoxy)-N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]acetohydrazide
2-(2,4-dichlorophenoxy)-N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8004-5942 |
| Compound Name: | 2-(2,4-dichlorophenoxy)-N'-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]acetohydrazide |
| Molecular Weight: | 495.1 |
| Molecular Formula: | C16 H13 Cl2 I N2 O4 |
| Smiles: | COc1cc(/C=N/NC(COc2ccc(cc2[Cl])[Cl])=O)cc(c1O)I |
| Stereo: | ACHIRAL |
| logP: | 4.3669 |
| logD: | 4.3165 |
| logSw: | -4.3071 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.036 |
| InChI Key: | BHVOBTYWKUVOHH-UHFFFAOYSA-N |