1,2-dimethoxy-4-(2-nitroethenyl)benzene
Chemical Structure Depiction of
1,2-dimethoxy-4-(2-nitroethenyl)benzene
1,2-dimethoxy-4-(2-nitroethenyl)benzene
Compound characteristics
| Compound ID: | 8004-6454 |
| Compound Name: | 1,2-dimethoxy-4-(2-nitroethenyl)benzene |
| Molecular Weight: | 209.2 |
| Molecular Formula: | C10 H11 N O4 |
| Smiles: | COc1ccc(/C=C/[N+]([O-])=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 2.0604 |
| logD: | 2.0604 |
| logSw: | -2.3417 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.758 |
| InChI Key: | SYJMYDMKPSZMSB-UHFFFAOYSA-N |