rel-(14xi,17xi)-2-hydroxy-15-methyl-8xi,9xi-5,6-epoxypregnan-20-one
Chemical Structure Depiction of
rel-(14xi,17xi)-2-hydroxy-15-methyl-8xi,9xi-5,6-epoxypregnan-20-one
rel-(14xi,17xi)-2-hydroxy-15-methyl-8xi,9xi-5,6-epoxypregnan-20-one
Compound characteristics
| Compound ID: | 8004-6664 |
| Compound Name: | rel-(14xi,17xi)-2-hydroxy-15-methyl-8xi,9xi-5,6-epoxypregnan-20-one |
| Molecular Weight: | 346.51 |
| Molecular Formula: | C22 H34 O3 |
| Smiles: | CC1CC(C(C)=O)[C@@]2(C)CCC3C(C[C@H]4[C@]5(CCC(C[C@]35C)O)O4)C12 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.5334 |
| logD: | 3.5334 |
| logSw: | -4.5613 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.792 |
| InChI Key: | BUDKLYQSLDHSFY-SCUIQVSKSA-N |