2-[(2-{[5-methyl-2-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]-4-nitrophenyl acetate
Chemical Structure Depiction of
2-[(2-{[5-methyl-2-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]-4-nitrophenyl acetate
2-[(2-{[5-methyl-2-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]-4-nitrophenyl acetate
Compound characteristics
| Compound ID: | 8004-6864 |
| Compound Name: | 2-[(2-{[5-methyl-2-(propan-2-yl)phenoxy]acetyl}hydrazinylidene)methyl]-4-nitrophenyl acetate |
| Molecular Weight: | 413.43 |
| Molecular Formula: | C21 H23 N3 O6 |
| Smiles: | CC(C)c1ccc(C)cc1OCC(N/N=C/c1cc(ccc1OC(C)=O)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4021 |
| logD: | 4.4013 |
| logSw: | -4.449 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 97.146 |
| InChI Key: | CMSRKVYDRYRPPZ-UHFFFAOYSA-N |