2-(4-butylphenoxy)-N'-[(4-nitrothiophen-2-yl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(4-butylphenoxy)-N'-[(4-nitrothiophen-2-yl)methylidene]acetohydrazide
2-(4-butylphenoxy)-N'-[(4-nitrothiophen-2-yl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8004-6906 |
| Compound Name: | 2-(4-butylphenoxy)-N'-[(4-nitrothiophen-2-yl)methylidene]acetohydrazide |
| Molecular Weight: | 361.42 |
| Molecular Formula: | C17 H19 N3 O4 S |
| Smiles: | CCCCc1ccc(cc1)OCC(N/N=C/c1cc(cs1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.783 |
| logD: | 4.7829 |
| logSw: | -4.5501 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.24 |
| InChI Key: | ZYXHBRWHIIJBCY-UHFFFAOYSA-N |