4-(4-pentylcyclohexyl)benzoic acid
Chemical Structure Depiction of
4-(4-pentylcyclohexyl)benzoic acid
4-(4-pentylcyclohexyl)benzoic acid
Compound characteristics
| Compound ID: | 8004-7039 |
| Compound Name: | 4-(4-pentylcyclohexyl)benzoic acid |
| Molecular Weight: | 274.4 |
| Molecular Formula: | C18 H26 O2 |
| Smiles: | CCCCCC1CCC(CC1)c1ccc(cc1)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.8919 |
| logD: | 3.9204 |
| logSw: | -5.7343 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.5671 |
| InChI Key: | YXKKMVGGPRVHIL-UHFFFAOYSA-N |