4-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenyl 2-chlorobenzoate
Chemical Structure Depiction of
4-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenyl 2-chlorobenzoate
4-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenyl 2-chlorobenzoate
Compound characteristics
| Compound ID: | 8004-7625 |
| Compound Name: | 4-{[(2-phenyl-1,3-benzoxazol-5-yl)imino]methyl}phenyl 2-chlorobenzoate |
| Molecular Weight: | 452.9 |
| Molecular Formula: | C27 H17 Cl N2 O3 |
| Smiles: | C(\c1ccc(cc1)OC(c1ccccc1[Cl])=O)=N/c1ccc2c(c1)nc(c1ccccc1)o2 |
| Stereo: | ACHIRAL |
| logP: | 6.4279 |
| logD: | 6.4275 |
| logSw: | -6.2093 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.554 |
| InChI Key: | DDULOECXYBCLBK-UHFFFAOYSA-N |