5-{[5-(2-nitrophenyl)furan-2-yl]methylidene}-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-{[5-(2-nitrophenyl)furan-2-yl]methylidene}-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one
5-{[5-(2-nitrophenyl)furan-2-yl]methylidene}-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 8004-7688 |
| Compound Name: | 5-{[5-(2-nitrophenyl)furan-2-yl]methylidene}-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one |
| Molecular Weight: | 467.5 |
| Molecular Formula: | C26 H17 N3 O4 S |
| Smiles: | C(=C1/C(N(\C(=N/c2ccccc2)S1)c1ccccc1)=O)/c1ccc(c2ccccc2[N+]([O-])=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.6634 |
| logD: | 5.6634 |
| logSw: | -5.852 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 64.903 |
| InChI Key: | RQAOYTLAJIFOHL-UHFFFAOYSA-N |