4-(benzyloxy)-N'-{[4-(pentyloxy)phenyl]methylidene}benzohydrazide
Chemical Structure Depiction of
4-(benzyloxy)-N'-{[4-(pentyloxy)phenyl]methylidene}benzohydrazide
4-(benzyloxy)-N'-{[4-(pentyloxy)phenyl]methylidene}benzohydrazide
Compound characteristics
| Compound ID: | 8004-7782 |
| Compound Name: | 4-(benzyloxy)-N'-{[4-(pentyloxy)phenyl]methylidene}benzohydrazide |
| Molecular Weight: | 416.52 |
| Molecular Formula: | C26 H28 N2 O3 |
| Smiles: | CCCCCOc1ccc(/C=N/NC(c2ccc(cc2)OCc2ccccc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.3611 |
| logD: | 6.3569 |
| logSw: | -5.5561 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.2 |
| InChI Key: | RLNJWTYPZVMHEB-UHFFFAOYSA-N |