2-(4-nitrophenyl)-2-oxoethyl 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate
Chemical Structure Depiction of
2-(4-nitrophenyl)-2-oxoethyl 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate
2-(4-nitrophenyl)-2-oxoethyl 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate
Compound characteristics
| Compound ID: | 8004-8043 |
| Compound Name: | 2-(4-nitrophenyl)-2-oxoethyl 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
| Molecular Weight: | 386.33 |
| Molecular Formula: | C19 H15 F N2 O6 |
| Smiles: | C1C(CN(C1=O)c1ccc(cc1)F)C(=O)OCC(c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2685 |
| logD: | 2.2685 |
| logSw: | -2.6445 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 84.474 |
| InChI Key: | JQWAQKBIEGZNFN-CYBMUJFWSA-N |