4-amino-N'-[(2,4-dichlorophenyl)methoxy]-N-phenyl-1,2,5-oxadiazole-3-carboximidamide
Chemical Structure Depiction of
4-amino-N'-[(2,4-dichlorophenyl)methoxy]-N-phenyl-1,2,5-oxadiazole-3-carboximidamide
4-amino-N'-[(2,4-dichlorophenyl)methoxy]-N-phenyl-1,2,5-oxadiazole-3-carboximidamide
Compound characteristics
| Compound ID: | 8005-0145 |
| Compound Name: | 4-amino-N'-[(2,4-dichlorophenyl)methoxy]-N-phenyl-1,2,5-oxadiazole-3-carboximidamide |
| Molecular Weight: | 378.22 |
| Molecular Formula: | C16 H13 Cl2 N5 O2 |
| Smiles: | C(c1ccc(cc1[Cl])[Cl])O/N=C(/c1c(N)non1)Nc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9731 |
| logD: | 4.9731 |
| logSw: | -5.1269 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 85.765 |
| InChI Key: | DZTQBKIVGOSLQQ-UHFFFAOYSA-N |