2,4-dichloro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]benzamide
Chemical Structure Depiction of
2,4-dichloro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]benzamide
2,4-dichloro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]benzamide
Compound characteristics
| Compound ID: | 8005-0295 |
| Compound Name: | 2,4-dichloro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]benzamide |
| Molecular Weight: | 470.33 |
| Molecular Formula: | C22 H13 Cl2 N3 O3 S |
| Smiles: | c1ccc(cc1)c1c(c2ccc(cc2)[N+]([O-])=O)sc(NC(c2ccc(cc2[Cl])[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.9334 |
| logD: | 6.9319 |
| logSw: | -6.6283 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.985 |
| InChI Key: | SDXOHNKLUWAIAY-UHFFFAOYSA-N |