4-(4-chlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1)
Chemical Structure Depiction of
4-(4-chlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1)
4-(4-chlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1)
Compound characteristics
| Compound ID: | 8005-0373 |
| Compound Name: | 4-(4-chlorophenyl)-N-(3-methoxyphenyl)-1,3-thiazol-2-amine--hydrogen bromide (1/1) |
| Molecular Weight: | 397.72 |
| Molecular Formula: | C16 H13 Cl N2 O S |
| Salt: | HBr |
| Smiles: | COc1cccc(c1)Nc1nc(cs1)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.9472 |
| logD: | 5.9472 |
| logSw: | -6.3806 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.4694 |
| InChI Key: | ACXKDXTUVJOMKX-UHFFFAOYSA-N |