2-ethoxy-4-({2-[(3,4,5-trimethoxybenzamido)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
Chemical Structure Depiction of
2-ethoxy-4-({2-[(3,4,5-trimethoxybenzamido)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
2-ethoxy-4-({2-[(3,4,5-trimethoxybenzamido)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate
Compound characteristics
| Compound ID: | 8005-0784 |
| Compound Name: | 2-ethoxy-4-({2-[(3,4,5-trimethoxybenzamido)acetyl]hydrazinylidene}methyl)phenyl 4-bromobenzoate |
| Molecular Weight: | 614.45 |
| Molecular Formula: | C28 H28 Br N3 O8 |
| Smiles: | CCOc1cc(/C=N/NC(CNC(c2cc(c(c(c2)OC)OC)OC)=O)=O)ccc1OC(c1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.413 |
| logD: | 4.4129 |
| logSw: | -4.4493 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 110.678 |
| InChI Key: | OMZGMUVYDCLFGG-UHFFFAOYSA-N |