2-(4-bromo-2-methoxyphenoxy)-N'-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(4-bromo-2-methoxyphenoxy)-N'-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]acetohydrazide
2-(4-bromo-2-methoxyphenoxy)-N'-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8005-1239 |
| Compound Name: | 2-(4-bromo-2-methoxyphenoxy)-N'-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]acetohydrazide |
| Molecular Weight: | 553 |
| Molecular Formula: | C16 H13 Br3 N2 O5 |
| Smiles: | COc1cc(ccc1OCC(N/N=C/c1cc(c(c(c1O)[Br])O)[Br])=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.6126 |
| logD: | 4.1793 |
| logSw: | -4.3285 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 81.515 |
| InChI Key: | HGTGSFBEMRLZHR-UHFFFAOYSA-N |