2-(3-bromoanilino)-N'-[(furan-2-yl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(3-bromoanilino)-N'-[(furan-2-yl)methylidene]acetohydrazide
2-(3-bromoanilino)-N'-[(furan-2-yl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8005-1529 |
| Compound Name: | 2-(3-bromoanilino)-N'-[(furan-2-yl)methylidene]acetohydrazide |
| Molecular Weight: | 322.16 |
| Molecular Formula: | C13 H12 Br N3 O2 |
| Smiles: | C(C(N/N=C\c1ccco1)=O)Nc1cccc(c1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.2982 |
| logD: | 3.2982 |
| logSw: | -3.5004 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.596 |
| InChI Key: | HWVIRJFTDWBPMC-UHFFFAOYSA-N |