N'-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide
Chemical Structure Depiction of
N'-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide
N'-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide
Compound characteristics
| Compound ID: | 8005-2465 |
| Compound Name: | N'-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| Molecular Weight: | 421.25 |
| Molecular Formula: | C18 H17 Br N2 O5 |
| Smiles: | CCOc1cc(/C=N/NC(c2ccc3c(c2)OCCO3)=O)cc(c1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.8197 |
| logD: | 2.7934 |
| logSw: | -3.1721 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.067 |
| InChI Key: | PSHKEXULRAAQPB-UHFFFAOYSA-N |