ethyl 5-amino-6-cyano-7-(2-methylphenyl)-2-[(2-methylphenyl)methylidene]-3-oxo-2,3-dihydro-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxylate
Chemical Structure Depiction of
ethyl 5-amino-6-cyano-7-(2-methylphenyl)-2-[(2-methylphenyl)methylidene]-3-oxo-2,3-dihydro-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxylate
ethyl 5-amino-6-cyano-7-(2-methylphenyl)-2-[(2-methylphenyl)methylidene]-3-oxo-2,3-dihydro-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxylate
Compound characteristics
| Compound ID: | 8005-2653 |
| Compound Name: | ethyl 5-amino-6-cyano-7-(2-methylphenyl)-2-[(2-methylphenyl)methylidene]-3-oxo-2,3-dihydro-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxylate |
| Molecular Weight: | 457.55 |
| Molecular Formula: | C26 H23 N3 O3 S |
| Smiles: | CCOC(C1C(C(C#N)=C(N)N2C=1SC(=C\c1ccccc1C)\C2=O)c1ccccc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9208 |
| logD: | 4.9208 |
| logSw: | -4.7272 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.1 |
| InChI Key: | DMQKSSCUZYZPBQ-NRFANRHFSA-N |