2-hydroxy-N'-[(4-methylphenyl)(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]benzohydrazide
Chemical Structure Depiction of
2-hydroxy-N'-[(4-methylphenyl)(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]benzohydrazide
2-hydroxy-N'-[(4-methylphenyl)(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | 8005-2807 |
| Compound Name: | 2-hydroxy-N'-[(4-methylphenyl)(1,3,5-triazatricyclo[3.3.1.1~3,7~]decan-7-yl)methylidene]benzohydrazide |
| Molecular Weight: | 391.47 |
| Molecular Formula: | C22 H25 N5 O2 |
| Smiles: | Cc1ccc(cc1)/C(C12CN3CN(C1)CN(C2)C3)=N/NC(c1ccccc1O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5186 |
| logD: | 3.4819 |
| logSw: | -3.1785 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.14 |
| InChI Key: | LRQYPIUQJKRZOT-UHFFFAOYSA-N |