(1,4-phenylene)bis[N-(5-bromopyridin-2-yl)methanimine]
Chemical Structure Depiction of
(1,4-phenylene)bis[N-(5-bromopyridin-2-yl)methanimine]
(1,4-phenylene)bis[N-(5-bromopyridin-2-yl)methanimine]
Compound characteristics
| Compound ID: | 8005-3477 |
| Compound Name: | (1,4-phenylene)bis[N-(5-bromopyridin-2-yl)methanimine] |
| Molecular Weight: | 444.13 |
| Molecular Formula: | C18 H12 Br2 N4 |
| Smiles: | C(\c1ccc(/C=N/c2ccc(cn2)[Br])cc1)=N/c1ccc(cn1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.0675 |
| logD: | 5.0673 |
| logSw: | -4.9046 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.902 |
| InChI Key: | HCBCOXVARXYYQX-UHFFFAOYSA-N |