4-({[(furan-2-yl)methyl]imino}methyl)-2-methoxyphenol
Chemical Structure Depiction of
4-({[(furan-2-yl)methyl]imino}methyl)-2-methoxyphenol
4-({[(furan-2-yl)methyl]imino}methyl)-2-methoxyphenol
Compound characteristics
| Compound ID: | 8005-4121 |
| Compound Name: | 4-({[(furan-2-yl)methyl]imino}methyl)-2-methoxyphenol |
| Molecular Weight: | 231.25 |
| Molecular Formula: | C13 H13 N O3 |
| Smiles: | COc1cc(/C=N/Cc2ccco2)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 2.1411 |
| logD: | 2.1304 |
| logSw: | -2.0905 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.828 |
| InChI Key: | HGRSNSKJFXSUTL-UHFFFAOYSA-N |