2-bromo-N'-({4-[(4-chlorophenyl)methoxy]phenyl}methylidene)benzohydrazide
Chemical Structure Depiction of
2-bromo-N'-({4-[(4-chlorophenyl)methoxy]phenyl}methylidene)benzohydrazide
2-bromo-N'-({4-[(4-chlorophenyl)methoxy]phenyl}methylidene)benzohydrazide
Compound characteristics
| Compound ID: | 8005-4622 |
| Compound Name: | 2-bromo-N'-({4-[(4-chlorophenyl)methoxy]phenyl}methylidene)benzohydrazide |
| Molecular Weight: | 443.73 |
| Molecular Formula: | C21 H16 Br Cl N2 O2 |
| Smiles: | C(c1ccc(cc1)[Cl])Oc1ccc(/C=N/NC(c2ccccc2[Br])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.1359 |
| logD: | 5.0675 |
| logSw: | -5.7141 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.782 |
| InChI Key: | XCCJHPVZTAKGOU-UHFFFAOYSA-N |