O-{4-[(4-iodophenyl)carbamoyl]phenyl} diethylcarbamothioate
Chemical Structure Depiction of
O-{4-[(4-iodophenyl)carbamoyl]phenyl} diethylcarbamothioate
O-{4-[(4-iodophenyl)carbamoyl]phenyl} diethylcarbamothioate
Compound characteristics
| Compound ID: | 8005-4658 |
| Compound Name: | O-{4-[(4-iodophenyl)carbamoyl]phenyl} diethylcarbamothioate |
| Molecular Weight: | 454.33 |
| Molecular Formula: | C18 H19 I N2 O2 S |
| Smiles: | CCN(CC)C(Oc1ccc(cc1)C(Nc1ccc(cc1)I)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 5.2895 |
| logD: | 5.2874 |
| logSw: | -5.2922 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.0912 |
| InChI Key: | UALILKAQAHFVDR-UHFFFAOYSA-N |