methylenebis(2-{[(2,4-dimethylphenyl)imino]methyl}-4,1-phenylene) bis(3-phenylprop-2-enoate)
Chemical Structure Depiction of
methylenebis(2-{[(2,4-dimethylphenyl)imino]methyl}-4,1-phenylene) bis(3-phenylprop-2-enoate)
methylenebis(2-{[(2,4-dimethylphenyl)imino]methyl}-4,1-phenylene) bis(3-phenylprop-2-enoate)
Compound characteristics
| Compound ID: | 8005-4851 |
| Compound Name: | methylenebis(2-{[(2,4-dimethylphenyl)imino]methyl}-4,1-phenylene) bis(3-phenylprop-2-enoate) |
| Molecular Weight: | 722.89 |
| Molecular Formula: | C49 H42 N2 O4 |
| Smiles: | Cc1ccc(c(C)c1)/N=C\c1cc(Cc2ccc(c(/C=N/c3ccc(C)cc3C)c2)OC(/C=C/c2ccccc2)=O)ccc1OC(/C=C/c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 12.102 |
| logD: | 12.1019 |
| logSw: | -5.6922 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 54.565 |
| InChI Key: | LORHUYQFERLTDF-UHFFFAOYSA-N |