5-[(3,4-dimethoxyphenyl)methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-[(3,4-dimethoxyphenyl)methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione
5-[(3,4-dimethoxyphenyl)methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 8005-5601 |
| Compound Name: | 5-[(3,4-dimethoxyphenyl)methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 382.37 |
| Molecular Formula: | C20 H18 N2 O6 |
| Smiles: | COc1ccc(cc1)N1C(C(=C/c2ccc(c(c2)OC)OC)\C(NC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9703 |
| logD: | 1.6673 |
| logSw: | -2.756 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.195 |
| InChI Key: | BHJNSTGXBLWHPT-UHFFFAOYSA-N |