4-{[(4-chloro-3-nitrophenyl)methylidene]amino}-2-(5-methyl-1H-benzimidazol-2-yl)phenol
Chemical Structure Depiction of
4-{[(4-chloro-3-nitrophenyl)methylidene]amino}-2-(5-methyl-1H-benzimidazol-2-yl)phenol
4-{[(4-chloro-3-nitrophenyl)methylidene]amino}-2-(5-methyl-1H-benzimidazol-2-yl)phenol
Compound characteristics
| Compound ID: | 8005-6085 |
| Compound Name: | 4-{[(4-chloro-3-nitrophenyl)methylidene]amino}-2-(5-methyl-1H-benzimidazol-2-yl)phenol |
| Molecular Weight: | 406.83 |
| Molecular Formula: | C21 H15 Cl N4 O3 |
| Smiles: | Cc1ccc2c(c1)nc(c1cc(ccc1O)/N=C/c1ccc(c(c1)[N+]([O-])=O)[Cl])[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 5.3628 |
| logD: | 5.3614 |
| logSw: | -5.6667 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.014 |
| InChI Key: | GWRHZYVWBNJCJZ-UHFFFAOYSA-N |