2-(2,4-dibromo-6-methoxyphenoxy)-N'-[(2-hydroxyphenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(2,4-dibromo-6-methoxyphenoxy)-N'-[(2-hydroxyphenyl)methylidene]acetohydrazide
2-(2,4-dibromo-6-methoxyphenoxy)-N'-[(2-hydroxyphenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 8005-6160 |
| Compound Name: | 2-(2,4-dibromo-6-methoxyphenoxy)-N'-[(2-hydroxyphenyl)methylidene]acetohydrazide |
| Molecular Weight: | 458.1 |
| Molecular Formula: | C16 H14 Br2 N2 O4 |
| Smiles: | COc1cc(cc(c1OCC(N/N=C/c1ccccc1O)=O)[Br])[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.3969 |
| logD: | 4.3955 |
| logSw: | -3.9991 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.192 |
| InChI Key: | RFNCLXXWIBPMAW-UHFFFAOYSA-N |