4-chloro-3,5-dimethyl-2-{[(3-methylphenyl)imino]methyl}phenol
Chemical Structure Depiction of
4-chloro-3,5-dimethyl-2-{[(3-methylphenyl)imino]methyl}phenol
4-chloro-3,5-dimethyl-2-{[(3-methylphenyl)imino]methyl}phenol
Compound characteristics
| Compound ID: | 8005-6857 |
| Compound Name: | 4-chloro-3,5-dimethyl-2-{[(3-methylphenyl)imino]methyl}phenol |
| Molecular Weight: | 273.76 |
| Molecular Formula: | C16 H16 Cl N O |
| Smiles: | Cc1cccc(c1)/N=C/c1c(cc(C)c(c1C)[Cl])O |
| Stereo: | ACHIRAL |
| logP: | 4.8422 |
| logD: | 4.8141 |
| logSw: | -4.4413 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.9139 |
| InChI Key: | AYOCWADGVLPVSC-UHFFFAOYSA-N |