4-chloro-2-{[(2,5-dimethylphenyl)imino]methyl}-3,5-dimethylphenol
Chemical Structure Depiction of
4-chloro-2-{[(2,5-dimethylphenyl)imino]methyl}-3,5-dimethylphenol
4-chloro-2-{[(2,5-dimethylphenyl)imino]methyl}-3,5-dimethylphenol
Compound characteristics
| Compound ID: | 8005-6863 |
| Compound Name: | 4-chloro-2-{[(2,5-dimethylphenyl)imino]methyl}-3,5-dimethylphenol |
| Molecular Weight: | 287.79 |
| Molecular Formula: | C17 H18 Cl N O |
| Smiles: | Cc1ccc(C)c(c1)/N=C/c1c(cc(C)c(c1C)[Cl])O |
| Stereo: | ACHIRAL |
| logP: | 5.3162 |
| logD: | 5.2878 |
| logSw: | -5.4887 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.2161 |
| InChI Key: | NAVYIRUNJJOOSE-UHFFFAOYSA-N |