methyl 4-[5-({[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]imino}methyl)furan-2-yl]benzoate
Chemical Structure Depiction of
methyl 4-[5-({[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]imino}methyl)furan-2-yl]benzoate
methyl 4-[5-({[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]imino}methyl)furan-2-yl]benzoate
Compound characteristics
| Compound ID: | 8005-6959 |
| Compound Name: | methyl 4-[5-({[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]imino}methyl)furan-2-yl]benzoate |
| Molecular Weight: | 491.33 |
| Molecular Formula: | C26 H16 Cl2 N2 O4 |
| Smiles: | COC(c1ccc(cc1)c1ccc(/C=N/c2ccc3c(c2)nc(c2ccc(c(c2)[Cl])[Cl])o3)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 7.4141 |
| logD: | 7.4139 |
| logSw: | -6.7227 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.92 |
| InChI Key: | NDNISTSHCCMSNK-UHFFFAOYSA-N |