4-({2-[(2,4-dichlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 3-fluorobenzoate
Chemical Structure Depiction of
4-({2-[(2,4-dichlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 3-fluorobenzoate
4-({2-[(2,4-dichlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 3-fluorobenzoate
Compound characteristics
| Compound ID: | 8005-6971 |
| Compound Name: | 4-({2-[(2,4-dichlorophenoxy)acetyl]hydrazinylidene}methyl)phenyl 3-fluorobenzoate |
| Molecular Weight: | 461.28 |
| Molecular Formula: | C22 H15 Cl2 F N2 O4 |
| Smiles: | C(C(N/N=C/c1ccc(cc1)OC(c1cccc(c1)F)=O)=O)Oc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.9089 |
| logD: | 4.9086 |
| logSw: | -5.1785 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.304 |
| InChI Key: | VFOXEMGFFICFIH-UHFFFAOYSA-N |