2-(1,3-benzothiazol-2-yl)-5-{[(3,4-dichlorophenyl)methylidene]amino}phenol
Chemical Structure Depiction of
2-(1,3-benzothiazol-2-yl)-5-{[(3,4-dichlorophenyl)methylidene]amino}phenol
2-(1,3-benzothiazol-2-yl)-5-{[(3,4-dichlorophenyl)methylidene]amino}phenol
Compound characteristics
| Compound ID: | 8005-7030 |
| Compound Name: | 2-(1,3-benzothiazol-2-yl)-5-{[(3,4-dichlorophenyl)methylidene]amino}phenol |
| Molecular Weight: | 399.3 |
| Molecular Formula: | C20 H12 Cl2 N2 O S |
| Smiles: | C(\c1ccc(c(c1)[Cl])[Cl])=N/c1ccc(c(c1)O)c1nc2ccccc2s1 |
| Stereo: | ACHIRAL |
| logP: | 6.965 |
| logD: | 6.9633 |
| logSw: | -6.4571 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.363 |
| InChI Key: | GKAYRJUTCMZNIO-UHFFFAOYSA-N |